C29H31N4O+ — CID 87729261
[4-[(2-phenylbenzimidazol-1-yl)methyl]phenyl]-(1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)methanone (PubChem CID 87729261) has the molecular formula C29H31N4O+ and a molecular weight of 451.59 g/mol. Its IUPAC name is [4-[(2-phenylbenzimidazol-1-yl)methyl]phenyl]-(1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)methanone.
| Compound Name | [4-[(2-phenylbenzimidazol-1-yl)methyl]phenyl]-(1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)methanone |
|---|---|
| PubChem CID | 87729261 |
| Molecular Formula | C29H31N4O+ |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | [4-[(2-phenylbenzimidazol-1-yl)methyl]phenyl]-(1-pyrrolidin-3-ylpyrrolidin-1-ium-1-yl)methanone |
| SMILES | O=C(c1ccc(Cn2c(-c3ccccc3)nc3ccccc32)cc1)[N+]1(C2CCNC2)CCCC1 |
| InChI | InChI=1S/C29H31N4O/c34-29(33(18-6-7-19-33)25-16-17-30-20-25)24-14-12-22(13-15-24)21-32-27-11-5-4-10-26(27)31-28(32)23-8-2-1-3-9-23/h1-5,8-15,25,30H,6-7,16-21H2/q+1 |
| InChIKey | NRPZRIFZBFHNHC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|