About 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate
5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate (PubChem CID 87729292) has the molecular formula C16H9F3N6O3S
and a molecular weight of 422.35 g/mol. Its IUPAC name is 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 87729292 |
| Molecular Formula | C16H9F3N6O3S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate |
| SMILES | N#Cc1cc2c(OS(=O)(=O)C(F)(F)F)ccnc2cn1.N#Cc1ccc(N)cn1 |
| InChI | InChI=1S/C10H4F3N3O3S.C6H5N3/c11-10(12,13)20(17,18)19-9-1-2-15-8-5-16-6(4-14)3-7(8)9;7-3-6-2-1-5(8)4-9-6/h1-3,5H;1-2,4H,8H2 |
| InChIKey | RZPNSBYRJOUTTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The IUPAC name of 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate (CID 87729292) is 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate is N#Cc1cc2c(OS(=O)(=O)C(F)(F)F)ccnc2cn1.N#Cc1ccc(N)cn1.
What is the InChIKey of 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The InChIKey is RZPNSBYRJOUTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F3N3O3S.C6H5N3/c11-10(12,13)20(17,18)19-9-1-2-15-8-5-16-6(4-14)3-7(8)9;7-3-6-2-1-5(8)4-9-6/h1-3,5H;1-2,4H,8H2.
What are the key properties of 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate has a molecular weight of 422.35 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyridine-2-carbonitrile;(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 87729292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).