C32H37F2N3O5 — CID 87729471
tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2S,3R,6S)-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(2-oxoethyl)oxan-3-yl]carbamate (PubChem CID 87729471) has the molecular formula C32H37F2N3O5 and a molecular weight of 581.66 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2S,3R,6S)-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(2-oxoethyl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2S,3R,6S)-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(2-oxoethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 87729471 |
| Molecular Formula | C32H37F2N3O5 |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2S,3R,6S)-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(2-oxoethyl)oxan-3-yl]carbamate |
| SMILES | COc1ccc2nccc(CC[C@H]3CC[C@@H](N(C/C=C/c4cc(F)ccc4F)C(=O)OC(C)(C)C)[C@H](CC=O)O3)c2n1 |
| InChI | InChI=1S/C32H37F2N3O5/c1-32(2,3)42-31(39)37(18-5-6-22-20-23(33)8-11-25(22)34)27-13-10-24(41-28(27)16-19-38)9-7-21-15-17-35-26-12-14-29(40-4)36-30(21)26/h5-6,8,11-12,14-15,17,19-20,24,27-28H,7,9-10,13,16,18H2,1-4H3/b6-5+/t24-,27+,28-/m0/s1 |
| InChIKey | XKIBAMHGFZGJCE-IAGAMUTDSA-N |
| XLogP | 6.30 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|