About dibutylalumanylium;trimethyl(oxido)silane
dibutylalumanylium;trimethyl(oxido)silane (PubChem CID 87730250) has the molecular formula C11H27AlOSi
and a molecular weight of 230.40 g/mol. Its IUPAC name is dibutylalumanylium;trimethyl(oxido)silane.
Molecular Properties
| Compound Name | dibutylalumanylium;trimethyl(oxido)silane |
| PubChem CID | 87730250 |
| Molecular Formula | C11H27AlOSi |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | dibutylalumanylium;trimethyl(oxido)silane |
| SMILES | CCCC[Al+]CCCC.C[Si](C)(C)[O-] |
| InChI | InChI=1S/2C4H9.C3H9OSi.Al/c2*1-3-4-2;1-5(2,3)4;/h2*1,3-4H2,2H3;1-3H3;/q;;-1;+1 |
| InChIKey | JJIWPEJWPOEYEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibutylalumanylium;trimethyl(oxido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutylalumanylium;trimethyl(oxido)silane?
The IUPAC name of dibutylalumanylium;trimethyl(oxido)silane (CID 87730250) is dibutylalumanylium;trimethyl(oxido)silane.
What is the SMILES notation for dibutylalumanylium;trimethyl(oxido)silane?
The canonical SMILES for dibutylalumanylium;trimethyl(oxido)silane is CCCC[Al+]CCCC.C[Si](C)(C)[O-].
What is the InChIKey of dibutylalumanylium;trimethyl(oxido)silane?
The InChIKey is JJIWPEJWPOEYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.C3H9OSi.Al/c2*1-3-4-2;1-5(2,3)4;/h2*1,3-4H2,2H3;1-3H3;/q;;-1;+1.
What are the key properties of dibutylalumanylium;trimethyl(oxido)silane?
dibutylalumanylium;trimethyl(oxido)silane has a molecular weight of 230.40 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylalumanylium;trimethyl(oxido)silane is sourced from PubChem (CID 87730250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).