C24H55ClN2O2 — CID 87730340
N,N-dimethyloctan-1-amine;2-(2-hydroxyethoxy)ethyl-dimethyl-octylazanium;chloride (PubChem CID 87730340) has the molecular formula C24H55ClN2O2 and a molecular weight of 439.17 g/mol. Its IUPAC name is N,N-dimethyloctan-1-amine;2-(2-hydroxyethoxy)ethyl-dimethyl-octylazanium;chloride.
| Compound Name | N,N-dimethyloctan-1-amine;2-(2-hydroxyethoxy)ethyl-dimethyl-octylazanium;chloride |
|---|---|
| PubChem CID | 87730340 |
| Molecular Formula | C24H55ClN2O2 |
| Molecular Weight | 439.17 g/mol |
| Exact Mass | 438.40 |
| IUPAC Name | N,N-dimethyloctan-1-amine;2-(2-hydroxyethoxy)ethyl-dimethyl-octylazanium;chloride |
| SMILES | CCCCCCCCN(C)C.CCCCCCCC[N+](C)(C)CCOCCO.[Cl-] |
| InChI | InChI=1S/C14H32NO2.C10H23N.ClH/c1-4-5-6-7-8-9-10-15(2,3)11-13-17-14-12-16;1-4-5-6-7-8-9-10-11(2)3;/h16H,4-14H2,1-3H3;4-10H2,1-3H3;1H/q+1;;/p-1 |
| InChIKey | NNAKTOIFZCTDNH-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|