About dibutylalumanylium;2,6-dimethylphenolate
dibutylalumanylium;2,6-dimethylphenolate (PubChem CID 87730394) has the molecular formula C16H27AlO
and a molecular weight of 262.37 g/mol. Its IUPAC name is dibutylalumanylium;2,6-dimethylphenolate.
Molecular Properties
| Compound Name | dibutylalumanylium;2,6-dimethylphenolate |
| PubChem CID | 87730394 |
| Molecular Formula | C16H27AlO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | dibutylalumanylium;2,6-dimethylphenolate |
| SMILES | CCCC[Al+]CCCC.Cc1cccc(C)c1[O-] |
| InChI | InChI=1S/C8H10O.2C4H9.Al/c1-6-4-3-5-7(2)8(6)9;2*1-3-4-2;/h3-5,9H,1-2H3;2*1,3-4H2,2H3;/q;;;+1/p-1 |
| InChIKey | AQGNGIKXASWVSO-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dibutylalumanylium;2,6-dimethylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutylalumanylium;2,6-dimethylphenolate?
The IUPAC name of dibutylalumanylium;2,6-dimethylphenolate (CID 87730394) is dibutylalumanylium;2,6-dimethylphenolate.
What is the SMILES notation for dibutylalumanylium;2,6-dimethylphenolate?
The canonical SMILES for dibutylalumanylium;2,6-dimethylphenolate is CCCC[Al+]CCCC.Cc1cccc(C)c1[O-].
What is the InChIKey of dibutylalumanylium;2,6-dimethylphenolate?
The InChIKey is AQGNGIKXASWVSO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O.2C4H9.Al/c1-6-4-3-5-7(2)8(6)9;2*1-3-4-2;/h3-5,9H,1-2H3;2*1,3-4H2,2H3;/q;;;+1/p-1.
What are the key properties of dibutylalumanylium;2,6-dimethylphenolate?
dibutylalumanylium;2,6-dimethylphenolate has a molecular weight of 262.37 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylalumanylium;2,6-dimethylphenolate is sourced from PubChem (CID 87730394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).