C24H31F3NO2+ — CID 87730815
6,7-dimethoxy-2-pentyl-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinolin-2-ium (PubChem CID 87730815) has the molecular formula C24H31F3NO2+ and a molecular weight of 422.51 g/mol. Its IUPAC name is 6,7-dimethoxy-2-pentyl-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinolin-2-ium.
| Compound Name | 6,7-dimethoxy-2-pentyl-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinolin-2-ium |
|---|---|
| PubChem CID | 87730815 |
| Molecular Formula | C24H31F3NO2+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 6,7-dimethoxy-2-pentyl-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinolin-2-ium |
| SMILES | CCCCC[N+]1(Cc2ccc(C(F)(F)F)cc2)CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C24H31F3NO2/c1-4-5-6-12-28(16-18-7-9-21(10-8-18)24(25,26)27)13-11-19-14-22(29-2)23(30-3)15-20(19)17-28/h7-10,14-15H,4-6,11-13,16-17H2,1-3H3/q+1 |
| InChIKey | UIWBZVKQURGEHC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|