C24H16Cl2F2N2OS — CID 87730995
[3-chloro-4-[5-(4-chlorophenyl)-2-[(3,4-difluorophenyl)methoxy]pyrimidin-4-yl]phenyl]methanethiol (PubChem CID 87730995) has the molecular formula C24H16Cl2F2N2OS and a molecular weight of 489.37 g/mol. Its IUPAC name is [3-chloro-4-[5-(4-chlorophenyl)-2-[(3,4-difluorophenyl)methoxy]pyrimidin-4-yl]phenyl]methanethiol.
| Compound Name | [3-chloro-4-[5-(4-chlorophenyl)-2-[(3,4-difluorophenyl)methoxy]pyrimidin-4-yl]phenyl]methanethiol |
|---|---|
| PubChem CID | 87730995 |
| Molecular Formula | C24H16Cl2F2N2OS |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | [3-chloro-4-[5-(4-chlorophenyl)-2-[(3,4-difluorophenyl)methoxy]pyrimidin-4-yl]phenyl]methanethiol |
| SMILES | Fc1ccc(COc2ncc(-c3ccc(Cl)cc3)c(-c3ccc(CS)cc3Cl)n2)cc1F |
| InChI | InChI=1S/C24H16Cl2F2N2OS/c25-17-5-3-16(4-6-17)19-11-29-24(31-12-14-2-8-21(27)22(28)10-14)30-23(19)18-7-1-15(13-32)9-20(18)26/h1-11,32H,12-13H2 |
| InChIKey | DWRFWOZGFVNKPF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|