About oxido-oxo-propoxysilane;tetramethylazanium
oxido-oxo-propoxysilane;tetramethylazanium (PubChem CID 87731712) has the molecular formula C7H19NO3Si
and a molecular weight of 193.32 g/mol. Its IUPAC name is oxido-oxo-propoxysilane;tetramethylazanium.
Molecular Properties
| Compound Name | oxido-oxo-propoxysilane;tetramethylazanium |
| PubChem CID | 87731712 |
| Molecular Formula | C7H19NO3Si |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | oxido-oxo-propoxysilane;tetramethylazanium |
| SMILES | CCCO[Si](=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C4H12N.C3H7O3Si/c1-5(2,3)4;1-2-3-6-7(4)5/h1-4H3;2-3H2,1H3/q+1;-1 |
| InChIKey | BNPHCHZPPAUSRZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxido-oxo-propoxysilane;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido-oxo-propoxysilane;tetramethylazanium?
The IUPAC name of oxido-oxo-propoxysilane;tetramethylazanium (CID 87731712) is oxido-oxo-propoxysilane;tetramethylazanium.
What is the SMILES notation for oxido-oxo-propoxysilane;tetramethylazanium?
The canonical SMILES for oxido-oxo-propoxysilane;tetramethylazanium is CCCO[Si](=O)[O-].C[N+](C)(C)C.
What is the InChIKey of oxido-oxo-propoxysilane;tetramethylazanium?
The InChIKey is BNPHCHZPPAUSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.C3H7O3Si/c1-5(2,3)4;1-2-3-6-7(4)5/h1-4H3;2-3H2,1H3/q+1;-1.
What are the key properties of oxido-oxo-propoxysilane;tetramethylazanium?
oxido-oxo-propoxysilane;tetramethylazanium has a molecular weight of 193.32 g/mol, XLogP of -0.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxido-oxo-propoxysilane;tetramethylazanium is sourced from PubChem (CID 87731712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).