About methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate
methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate (PubChem CID 87731790) has the molecular formula C17H12ClN3O2
and a molecular weight of 325.76 g/mol. Its IUPAC name is methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate |
| PubChem CID | 87731790 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)Cc1c(-c3ccc(Cl)nc3)n[nH]c1-2 |
| InChI | InChI=1S/C17H12ClN3O2/c1-23-17(22)9-2-4-12-11(6-9)7-13-15(20-21-16(12)13)10-3-5-14(18)19-8-10/h2-6,8H,7H2,1H3,(H,20,21) |
| InChIKey | YWIOTHQYXSKPRN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate?
The IUPAC name of methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate (CID 87731790) is methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate.
What is the SMILES notation for methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate?
The canonical SMILES for methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate is COC(=O)c1ccc2c(c1)Cc1c(-c3ccc(Cl)nc3)n[nH]c1-2.
What is the InChIKey of methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate?
The InChIKey is YWIOTHQYXSKPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClN3O2/c1-23-17(22)9-2-4-12-11(6-9)7-13-15(20-21-16(12)13)10-3-5-14(18)19-8-10/h2-6,8H,7H2,1H3,(H,20,21).
What are the key properties of methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate?
methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate has a molecular weight of 325.76 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6-chloro-3-pyridinyl)-1,4-dihydroindeno[2,1-d]pyrazole-6-carboxylate is sourced from PubChem (CID 87731790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).