About O-(3,4,4-trifluorobut-3-enyl) carbamothioate
O-(3,4,4-trifluorobut-3-enyl) carbamothioate (PubChem CID 87731803) has the molecular formula C5H6F3NOS
and a molecular weight of 185.17 g/mol. Its IUPAC name is O-(3,4,4-trifluorobut-3-enyl) carbamothioate.
Molecular Properties
| Compound Name | O-(3,4,4-trifluorobut-3-enyl) carbamothioate |
| PubChem CID | 87731803 |
| Molecular Formula | C5H6F3NOS |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | O-(3,4,4-trifluorobut-3-enyl) carbamothioate |
| SMILES | NC(=S)OCCC(F)=C(F)F |
| InChI | InChI=1S/C5H6F3NOS/c6-3(4(7)8)1-2-10-5(9)11/h1-2H2,(H2,9,11) |
| InChIKey | VRKJQHCAILQALM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3,4,4-trifluorobut-3-enyl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3,4,4-trifluorobut-3-enyl) carbamothioate?
The IUPAC name of O-(3,4,4-trifluorobut-3-enyl) carbamothioate (CID 87731803) is O-(3,4,4-trifluorobut-3-enyl) carbamothioate.
What is the SMILES notation for O-(3,4,4-trifluorobut-3-enyl) carbamothioate?
The canonical SMILES for O-(3,4,4-trifluorobut-3-enyl) carbamothioate is NC(=S)OCCC(F)=C(F)F.
What is the InChIKey of O-(3,4,4-trifluorobut-3-enyl) carbamothioate?
The InChIKey is VRKJQHCAILQALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3NOS/c6-3(4(7)8)1-2-10-5(9)11/h1-2H2,(H2,9,11).
What are the key properties of O-(3,4,4-trifluorobut-3-enyl) carbamothioate?
O-(3,4,4-trifluorobut-3-enyl) carbamothioate has a molecular weight of 185.17 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3,4,4-trifluorobut-3-enyl) carbamothioate is sourced from PubChem (CID 87731803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).