C24H32N4O2 — CID 8773224
(2S)-N-benzyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 8773224) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-benzyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8773224 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (2S)-N-benzyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN([C@@H](C)C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-3-21-11-7-8-12-22(21)26-23(29)18-27-13-15-28(16-14-27)19(2)24(30)25-17-20-9-5-4-6-10-20/h4-12,19H,3,13-18H2,1-2H3,(H,25,30)(H,26,29)/t19-/m0/s1 |
| InChIKey | RXNZLDCIRCQPQD-IBGZPJMESA-N |
| XLogP | 2.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |