About 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol
2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol (PubChem CID 87732377) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol |
| PubChem CID | 87732377 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol |
| SMILES | OCc1ccc2c(c1)C=CC(CO)(c1ccccc1O)C2 |
| InChI | InChI=1S/C18H18O3/c19-11-13-5-6-15-10-18(12-20,8-7-14(15)9-13)16-3-1-2-4-17(16)21/h1-9,19-21H,10-12H2 |
| InChIKey | KFGOUPOBMRGNTM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol?
The IUPAC name of 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol (CID 87732377) is 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol.
What is the SMILES notation for 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol?
The canonical SMILES for 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol is OCc1ccc2c(c1)C=CC(CO)(c1ccccc1O)C2.
What is the InChIKey of 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol?
The InChIKey is KFGOUPOBMRGNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c19-11-13-5-6-15-10-18(12-20,8-7-14(15)9-13)16-3-1-2-4-17(16)21/h1-9,19-21H,10-12H2.
What are the key properties of 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol?
2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol has a molecular weight of 282.34 g/mol, XLogP of 2.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-bis(hydroxymethyl)-1H-naphthalen-2-yl]phenol is sourced from PubChem (CID 87732377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).