C36H24Br2F18S5 — CID 87732403
2,5-bis[5-(5-bromothiophen-2-yl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophen-2-yl]-3,4-dibutylthiophene (PubChem CID 87732403) has the molecular formula C36H24Br2F18S5 and a molecular weight of 1118.69 g/mol. Its IUPAC name is 2,5-bis[5-(5-bromothiophen-2-yl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophen-2-yl]-3,4-dibutylthiophene.
| Compound Name | 2,5-bis[5-(5-bromothiophen-2-yl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophen-2-yl]-3,4-dibutylthiophene |
|---|---|
| PubChem CID | 87732403 |
| Molecular Formula | C36H24Br2F18S5 |
| Molecular Weight | 1118.69 g/mol |
| Exact Mass | 1115.86 |
| IUPAC Name | 2,5-bis[5-(5-bromothiophen-2-yl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophen-2-yl]-3,4-dibutylthiophene |
| SMILES | CCCCc1c(-c2cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(-c3ccc(Br)s3)s2)sc(-c2cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(-c3ccc(Br)s3)s2)c1CCCC |
| InChI | InChI=1S/C36H24Br2F18S5/c1-3-5-7-15-16(8-6-4-2)26(22-14-18(28(60-22)20-10-12-24(38)58-20)30(41,42)32(45,46)34(49,50)36(54,55)56)61-25(15)21-13-17(27(59-21)19-9-11-23(37)57-19)29(39,40)31(43,44)33(47,48)35(51,52)53/h9-14H,3-8H2,1-2H3 |
| InChIKey | RIWUSCRQZSOFPA-UHFFFAOYSA-N |
| XLogP | 18.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.69 |
| LogP ≤ 5 | 18.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|