C20H27N4O3S2+ — CID 87732980
4-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-5-methyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 87732980) has the molecular formula C20H27N4O3S2+ and a molecular weight of 435.60 g/mol. Its IUPAC name is 4-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-5-methyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-5-methyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87732980 |
| Molecular Formula | C20H27N4O3S2+ |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-5-methyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | Cc1c[n+](CCCCS(=O)(=O)O)c(/N=N/c2cc3c4c(c2)CCCN4CCC3)s1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-15-14-24(8-2-3-11-29(25,26)27)20(28-15)22-21-18-12-16-6-4-9-23-10-5-7-17(13-18)19(16)23/h12-14H,2-11H2,1H3/p+1 |
| InChIKey | HFGMBXPXBMPPSJ-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|