About 2-chloropyridazin-3-one
2-chloropyridazin-3-one (PubChem CID 87733115) has the molecular formula C4H3ClN2O
and a molecular weight of 130.53 g/mol. Its IUPAC name is 2-chloropyridazin-3-one.
Molecular Properties
| Compound Name | 2-chloropyridazin-3-one |
| PubChem CID | 87733115 |
| Molecular Formula | C4H3ClN2O |
| Molecular Weight | 130.53 g/mol |
| Exact Mass | 129.99 |
| IUPAC Name | 2-chloropyridazin-3-one |
| SMILES | O=c1cccnn1Cl |
| InChI | InChI=1S/C4H3ClN2O/c5-7-4(8)2-1-3-6-7/h1-3H |
| InChIKey | FPCLISZEWJIVEW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.53 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridazin-3-one?
The IUPAC name of 2-chloropyridazin-3-one (CID 87733115) is 2-chloropyridazin-3-one.
What is the SMILES notation for 2-chloropyridazin-3-one?
The canonical SMILES for 2-chloropyridazin-3-one is O=c1cccnn1Cl.
What is the InChIKey of 2-chloropyridazin-3-one?
The InChIKey is FPCLISZEWJIVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN2O/c5-7-4(8)2-1-3-6-7/h1-3H.
What are the key properties of 2-chloropyridazin-3-one?
2-chloropyridazin-3-one has a molecular weight of 130.53 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridazin-3-one is sourced from PubChem (CID 87733115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).