About 2,4-dimethylphenol;yttrium
2,4-dimethylphenol;yttrium (PubChem CID 87733318) has the molecular formula C8H10OY
and a molecular weight of 211.07 g/mol. Its IUPAC name is 2,4-dimethylphenol;yttrium.
Molecular Properties
| Compound Name | 2,4-dimethylphenol;yttrium |
| PubChem CID | 87733318 |
| Molecular Formula | C8H10OY |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 2,4-dimethylphenol;yttrium |
| SMILES | Cc1ccc(O)c(C)c1.[Y] |
| InChI | InChI=1S/C8H10O.Y/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3; |
| InChIKey | CEJCASGHHLFKEQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylphenol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylphenol;yttrium?
The IUPAC name of 2,4-dimethylphenol;yttrium (CID 87733318) is 2,4-dimethylphenol;yttrium.
What is the SMILES notation for 2,4-dimethylphenol;yttrium?
The canonical SMILES for 2,4-dimethylphenol;yttrium is Cc1ccc(O)c(C)c1.[Y].
What is the InChIKey of 2,4-dimethylphenol;yttrium?
The InChIKey is CEJCASGHHLFKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.Y/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3;.
What are the key properties of 2,4-dimethylphenol;yttrium?
2,4-dimethylphenol;yttrium has a molecular weight of 211.07 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylphenol;yttrium is sourced from PubChem (CID 87733318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).