About ethanesulfonic acid;3-methyloxet-2-one
ethanesulfonic acid;3-methyloxet-2-one (PubChem CID 87733563) has the molecular formula C6H10O5S
and a molecular weight of 194.21 g/mol. Its IUPAC name is ethanesulfonic acid;3-methyloxet-2-one.
Molecular Properties
| Compound Name | ethanesulfonic acid;3-methyloxet-2-one |
| PubChem CID | 87733563 |
| Molecular Formula | C6H10O5S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | ethanesulfonic acid;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CCS(=O)(=O)O |
| InChI | InChI=1S/C4H4O2.C2H6O3S/c1-3-2-6-4(3)5;1-2-6(3,4)5/h2H,1H3;2H2,1H3,(H,3,4,5) |
| InChIKey | BUKRAOAKUJLXKU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethanesulfonic acid;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfonic acid;3-methyloxet-2-one?
The IUPAC name of ethanesulfonic acid;3-methyloxet-2-one (CID 87733563) is ethanesulfonic acid;3-methyloxet-2-one.
What is the SMILES notation for ethanesulfonic acid;3-methyloxet-2-one?
The canonical SMILES for ethanesulfonic acid;3-methyloxet-2-one is CC1=COC1=O.CCS(=O)(=O)O.
What is the InChIKey of ethanesulfonic acid;3-methyloxet-2-one?
The InChIKey is BUKRAOAKUJLXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O2.C2H6O3S/c1-3-2-6-4(3)5;1-2-6(3,4)5/h2H,1H3;2H2,1H3,(H,3,4,5).
What are the key properties of ethanesulfonic acid;3-methyloxet-2-one?
ethanesulfonic acid;3-methyloxet-2-one has a molecular weight of 194.21 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfonic acid;3-methyloxet-2-one is sourced from PubChem (CID 87733563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).