C28H40N6O5 — CID 87733618
[3-[3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 87733618) has the molecular formula C28H40N6O5 and a molecular weight of 540.67 g/mol. Its IUPAC name is [3-[3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [3-[3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 87733618 |
| Molecular Formula | C28H40N6O5 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | [3-[3-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propylamino]phenyl]-2-ethoxypropanoyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCOC(Cc1cccc(NCCCN2CCOc3ccccc32)c1)C(=O)OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C28H40N6O5/c1-2-37-25(27(36)39-26(35)22(29)10-6-13-33-28(30)31)19-20-8-5-9-21(18-20)32-14-7-15-34-16-17-38-24-12-4-3-11-23(24)34/h3-5,8-9,11-12,18,22,25,32H,2,6-7,10,13-17,19,29H2,1H3,(H4,30,31,33)/t22-,25?/m0/s1 |
| InChIKey | BAFUBRCTSJTYOC-XADRRFQNSA-N |
| XLogP | 1.79 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|