C24H22N2O12S2 — CID 87733782
[2-(4-methoxyphenyl)sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 4-methoxybenzenesulfonate (PubChem CID 87733782) has the molecular formula C24H22N2O12S2 and a molecular weight of 594.58 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 4-methoxybenzenesulfonate.
| Compound Name | [2-(4-methoxyphenyl)sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 87733782 |
| Molecular Formula | C24H22N2O12S2 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | [2-(4-methoxyphenyl)sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON2C(=O)C3CC4C(=O)N(OS(=O)(=O)c5ccc(OC)cc5)C(=O)C4CC3C2=O)cc1 |
| InChI | InChI=1S/C24H22N2O12S2/c1-35-13-3-7-15(8-4-13)39(31,32)37-25-21(27)17-11-19-20(12-18(17)22(25)28)24(30)26(23(19)29)38-40(33,34)16-9-5-14(36-2)6-10-16/h3-10,17-20H,11-12H2,1-2H3 |
| InChIKey | WLZOXFGTBUBQPH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|