C11H13F6N5O — CID 87733800
3-amino-5,5,5-trifluoro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pentan-1-one (PubChem CID 87733800) has the molecular formula C11H13F6N5O and a molecular weight of 345.25 g/mol. Its IUPAC name is 3-amino-5,5,5-trifluoro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pentan-1-one.
| Compound Name | 3-amino-5,5,5-trifluoro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pentan-1-one |
|---|---|
| PubChem CID | 87733800 |
| Molecular Formula | C11H13F6N5O |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-amino-5,5,5-trifluoro-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]pentan-1-one |
| SMILES | NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)CC(F)(F)F |
| InChI | InChI=1S/C11H13F6N5O/c12-10(13,14)4-6(18)3-8(23)21-1-2-22-7(5-21)19-20-9(22)11(15,16)17/h6H,1-5,18H2 |
| InChIKey | DHKFIKPRKIDDJV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |