About (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide
(2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide (PubChem CID 87733832) has the molecular formula C7H16N2OS
and a molecular weight of 176.28 g/mol. Its IUPAC name is (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide |
| PubChem CID | 87733832 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide |
| SMILES | CCN(CC)C(=O)[C@@H](N)CS |
| InChI | InChI=1S/C7H16N2OS/c1-3-9(4-2)7(10)6(8)5-11/h6,11H,3-5,8H2,1-2H3/t6-/m0/s1 |
| InChIKey | KREDMOLDFZJUFK-LURJTMIESA-N |
| XLogP | 0.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide?
The IUPAC name of (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide (CID 87733832) is (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide.
What is the SMILES notation for (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide?
The canonical SMILES for (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide is CCN(CC)C(=O)[C@@H](N)CS.
What is the InChIKey of (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide?
The InChIKey is KREDMOLDFZJUFK-LURJTMIESA-N. The full InChI is InChI=1S/C7H16N2OS/c1-3-9(4-2)7(10)6(8)5-11/h6,11H,3-5,8H2,1-2H3/t6-/m0/s1.
What are the key properties of (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide?
(2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide has a molecular weight of 176.28 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N,N-diethyl-3-sulfanylpropanamide is sourced from PubChem (CID 87733832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).