C21H15Br2N2O10S2+ — CID 87733845
[10-(4-bromophenyl)sulfonyloxy-4,7,9,11-tetraoxo-10-aza-4-azoniatricyclo[6.3.0.02,6]undecan-5-yl] 4-bromobenzenesulfonate (PubChem CID 87733845) has the molecular formula C21H15Br2N2O10S2+ and a molecular weight of 679.30 g/mol. Its IUPAC name is [10-(4-bromophenyl)sulfonyloxy-4,7,9,11-tetraoxo-10-aza-4-azoniatricyclo[6.3.0.02,6]undecan-5-yl] 4-bromobenzenesulfonate.
| Compound Name | [10-(4-bromophenyl)sulfonyloxy-4,7,9,11-tetraoxo-10-aza-4-azoniatricyclo[6.3.0.02,6]undecan-5-yl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 87733845 |
| Molecular Formula | C21H15Br2N2O10S2+ |
| Molecular Weight | 679.30 g/mol |
| Exact Mass | 676.85 |
| IUPAC Name | [10-(4-bromophenyl)sulfonyloxy-4,7,9,11-tetraoxo-10-aza-4-azoniatricyclo[6.3.0.02,6]undecan-5-yl] 4-bromobenzenesulfonate |
| SMILES | O=C1C2C(=O)N(OS(=O)(=O)c3ccc(Br)cc3)C(=O)C2C2C[N+](=O)C(OS(=O)(=O)c3ccc(Br)cc3)C12 |
| InChI | InChI=1S/C21H15Br2N2O10S2/c22-10-1-5-12(6-2-10)36(30,31)34-21-16-14(9-24(21)29)15-17(18(16)26)20(28)25(19(15)27)35-37(32,33)13-7-3-11(23)4-8-13/h1-8,14-17,21H,9H2/q+1 |
| InChIKey | WMYVCITZNONWIH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 161.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|