C18H32O6 — CID 87733987
4-O-(5-hydroxy-2,3,3-trimethylpentan-2-yl) 1-O-[2-[(2-methylpropan-2-yl)oxy]ethyl] (E)-but-2-enedioate (PubChem CID 87733987) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-O-(5-hydroxy-2,3,3-trimethylpentan-2-yl) 1-O-[2-[(2-methylpropan-2-yl)oxy]ethyl] (E)-but-2-enedioate.
| Compound Name | 4-O-(5-hydroxy-2,3,3-trimethylpentan-2-yl) 1-O-[2-[(2-methylpropan-2-yl)oxy]ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87733987 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-O-(5-hydroxy-2,3,3-trimethylpentan-2-yl) 1-O-[2-[(2-methylpropan-2-yl)oxy]ethyl] (E)-but-2-enedioate |
| SMILES | CC(C)(C)OCCOC(=O)/C=C/C(=O)OC(C)(C)C(C)(C)CCO |
| InChI | InChI=1S/C18H32O6/c1-16(2,3)23-13-12-22-14(20)8-9-15(21)24-18(6,7)17(4,5)10-11-19/h8-9,19H,10-13H2,1-7H3/b9-8+ |
| InChIKey | OXSCZNDNOWWNTM-CMDGGOBGSA-N |
| XLogP | 2.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|