C12H20O6 — CID 87734415
2-(2-ethoxy-2-oxoethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 87734415) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87734415 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H20O6/c1-5-17-9(13)6-8(11(15)16)7-10(14)18-12(2,3)4/h8H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | VBRULOCEXTZKAK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |