C26H14F12N2O10S2 — CID 87734779
[2-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 87734779) has the molecular formula C26H14F12N2O10S2 and a molecular weight of 806.51 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87734779 |
| Molecular Formula | C26H14F12N2O10S2 |
| Molecular Weight | 806.51 g/mol |
| Exact Mass | 805.99 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxy-1,3,5,7-tetraoxo-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindol-6-yl] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | O=C1C2CC3C(=O)N(OS(=O)(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(=O)C3CC2C(=O)N1OS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H14F12N2O10S2/c27-23(28,29)9-1-10(24(30,31)32)4-13(3-9)51(45,46)49-39-19(41)15-7-17-18(8-16(15)20(39)42)22(44)40(21(17)43)50-52(47,48)14-5-11(25(33,34)35)2-12(6-14)26(36,37)38/h1-6,15-18H,7-8H2 |
| InChIKey | CDISQOCSTFNUIR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|