2-trichlorogermylpropanoyl chloride

C3H4Cl4GeO — CID 87735041

IUPAC2-trichlorogermylpropanoyl chloride
SMILESCC(C(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C3H4Cl4GeO/c1-2(3(4)9)8(5,6)7/h2H,1H3
InChIKeyZMWCLUGNEQEDKN-UHFFFAOYSA-N
MW270.49 g/mol
LogP2.80
Rot. Bonds2

About 2-trichlorogermylpropanoyl chloride

2-trichlorogermylpropanoyl chloride (PubChem CID 87735041) has the molecular formula C3H4Cl4GeO and a molecular weight of 270.49 g/mol. Its IUPAC name is 2-trichlorogermylpropanoyl chloride.

Molecular Properties

Compound Name2-trichlorogermylpropanoyl chloride
PubChem CID87735041
Molecular FormulaC3H4Cl4GeO
Molecular Weight270.49 g/mol
Exact Mass269.82
IUPAC Name2-trichlorogermylpropanoyl chloride
SMILESCC(C(=O)Cl)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C3H4Cl4GeO/c1-2(3(4)9)8(5,6)7/h2H,1H3
InChIKeyZMWCLUGNEQEDKN-UHFFFAOYSA-N
XLogP2.80
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.49
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-trichlorogermylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-trichlorogermylpropanoyl chloride?
The IUPAC name of 2-trichlorogermylpropanoyl chloride (CID 87735041) is 2-trichlorogermylpropanoyl chloride.
What is the SMILES notation for 2-trichlorogermylpropanoyl chloride?
The canonical SMILES for 2-trichlorogermylpropanoyl chloride is CC(C(=O)Cl)[Ge](Cl)(Cl)Cl.
What is the InChIKey of 2-trichlorogermylpropanoyl chloride?
The InChIKey is ZMWCLUGNEQEDKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Cl4GeO/c1-2(3(4)9)8(5,6)7/h2H,1H3.
What are the key properties of 2-trichlorogermylpropanoyl chloride?
2-trichlorogermylpropanoyl chloride has a molecular weight of 270.49 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trichlorogermylpropanoyl chloride is sourced from PubChem (CID 87735041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).