C23H27FN4O3S2 — CID 87735148
[3-[3-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl] methanesulfonate (PubChem CID 87735148) has the molecular formula C23H27FN4O3S2 and a molecular weight of 490.63 g/mol. Its IUPAC name is [3-[3-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl] methanesulfonate.
| Compound Name | [3-[3-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 87735148 |
| Molecular Formula | C23H27FN4O3S2 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [3-[3-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl] methanesulfonate |
| SMILES | Cn1c(SCCCN2CCc3ccc(OS(C)(=O)=O)cc3CC2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C23H27FN4O3S2/c1-27-22(20-6-3-4-7-21(20)24)25-26-23(27)32-15-5-12-28-13-10-17-8-9-19(31-33(2,29)30)16-18(17)11-14-28/h3-4,6-9,16H,5,10-15H2,1-2H3 |
| InChIKey | WZUQSTKIOAAGLF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|