C32H24Cl7N3O3S — CID 87735582
7-[(2R,3S,4S,5R)-3,4-bis[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]thiolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidine (PubChem CID 87735582) has the molecular formula C32H24Cl7N3O3S and a molecular weight of 778.80 g/mol. Its IUPAC name is 7-[(2R,3S,4S,5R)-3,4-bis[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]thiolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(2R,3S,4S,5R)-3,4-bis[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]thiolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 87735582 |
| Molecular Formula | C32H24Cl7N3O3S |
| Molecular Weight | 778.80 g/mol |
| Exact Mass | 774.94 |
| IUPAC Name | 7-[(2R,3S,4S,5R)-3,4-bis[(2,4-dichlorophenyl)methoxy]-5-[(2,4-dichlorophenyl)methoxymethyl]thiolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ccc(COC[C@H]2S[C@@H](n3ccc4c(Cl)ncnc43)[C@@H](OCc3ccc(Cl)cc3Cl)[C@@H]2OCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H24Cl7N3O3S/c33-20-4-1-17(24(36)9-20)12-43-15-27-28(44-13-18-2-5-21(34)10-25(18)37)29(45-14-19-3-6-22(35)11-26(19)38)32(46-27)42-8-7-23-30(39)40-16-41-31(23)42/h1-11,16,27-29,32H,12-15H2/t27-,28-,29+,32-/m1/s1 |
| InChIKey | KCHIMTAWMGTEJM-YZALVSPHSA-N |
| XLogP | 11.01 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.80 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |