C52H42BF20I — CID 87735618
bis(4-octylphenyl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87735618) has the molecular formula C52H42BF20I and a molecular weight of 1184.58 g/mol. Its IUPAC name is bis(4-octylphenyl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis(4-octylphenyl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87735618 |
| Molecular Formula | C52H42BF20I |
| Molecular Weight | 1184.58 g/mol |
| Exact Mass | 1184.21 |
| IUPAC Name | bis(4-octylphenyl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCCCCCCc1ccc([I+]c2ccc(CCCCCCCC)cc2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H42I.C24BF20/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)29-28-23-19-26(20-24-28)16-14-12-10-8-6-4-2;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h17-24H,3-16H2,1-2H3;/q+1;-1 |
| InChIKey | MKIFLBCWNWLJOK-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1184.58 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|