About ethyl 2-(1,3-thiazol-5-yloxyimino)acetate
ethyl 2-(1,3-thiazol-5-yloxyimino)acetate (PubChem CID 87735685) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is ethyl 2-(1,3-thiazol-5-yloxyimino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-thiazol-5-yloxyimino)acetate |
| PubChem CID | 87735685 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | ethyl 2-(1,3-thiazol-5-yloxyimino)acetate |
| SMILES | CCOC(=O)C=NOc1cncs1 |
| InChI | InChI=1S/C7H8N2O3S/c1-2-11-6(10)3-9-12-7-4-8-5-13-7/h3-5H,2H2,1H3 |
| InChIKey | BYUXERWFITXYJY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1,3-thiazol-5-yloxyimino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-thiazol-5-yloxyimino)acetate?
The IUPAC name of ethyl 2-(1,3-thiazol-5-yloxyimino)acetate (CID 87735685) is ethyl 2-(1,3-thiazol-5-yloxyimino)acetate.
What is the SMILES notation for ethyl 2-(1,3-thiazol-5-yloxyimino)acetate?
The canonical SMILES for ethyl 2-(1,3-thiazol-5-yloxyimino)acetate is CCOC(=O)C=NOc1cncs1.
What is the InChIKey of ethyl 2-(1,3-thiazol-5-yloxyimino)acetate?
The InChIKey is BYUXERWFITXYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-2-11-6(10)3-9-12-7-4-8-5-13-7/h3-5H,2H2,1H3.
What are the key properties of ethyl 2-(1,3-thiazol-5-yloxyimino)acetate?
ethyl 2-(1,3-thiazol-5-yloxyimino)acetate has a molecular weight of 200.22 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-thiazol-5-yloxyimino)acetate is sourced from PubChem (CID 87735685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).