C64H42N8 — CID 87736674
5,10,15,20-tetrakis(2-pyridin-4-ylphenyl)-21,23-dihydroporphyrin (PubChem CID 87736674) has the molecular formula C64H42N8 and a molecular weight of 923.10 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2-pyridin-4-ylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2-pyridin-4-ylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 87736674 |
| Molecular Formula | C64H42N8 |
| Molecular Weight | 923.10 g/mol |
| Exact Mass | 922.35 |
| IUPAC Name | 5,10,15,20-tetrakis(2-pyridin-4-ylphenyl)-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1-c1ccncc1)c1ccc([nH]1)c(-c1ccccc1-c1ccncc1)c1nc(c(-c3ccccc3-c3ccncc3)c3ccc([nH]3)c2-c2ccccc2-c2ccncc2)C=C1 |
| InChI | InChI=1S/C64H42N8/c1-5-13-49(45(9-1)41-25-33-65-34-26-41)61-53-17-19-55(69-53)62(50-14-6-2-10-46(50)42-27-35-66-36-28-42)57-21-23-59(71-57)64(52-16-8-4-12-48(52)44-31-39-68-40-32-44)60-24-22-58(72-60)63(56-20-18-54(61)70-56)51-15-7-3-11-47(51)43-29-37-67-38-30-43/h1-40,69,72H/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | OWIJKYSAVCYSNH-WJVFOVLXSA-N |
| XLogP | 15.57 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.10 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |