About [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane
[3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane (PubChem CID 87736977) has the molecular formula C7H8F6
and a molecular weight of 206.13 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane.
Molecular Properties
| Compound Name | [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane |
| PubChem CID | 87736977 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane |
| SMILES | FC(F)(F)C(CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C7H8F6/c8-6(9,10)5(7(11,12)13)3-4-1-2-4/h4-5H,1-3H2 |
| InChIKey | UJXOREHSULLDHJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane?
The IUPAC name of [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane (CID 87736977) is [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane.
What is the SMILES notation for [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane?
The canonical SMILES for [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane is FC(F)(F)C(CC1CC1)C(F)(F)F.
What is the InChIKey of [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane?
The InChIKey is UJXOREHSULLDHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F6/c8-6(9,10)5(7(11,12)13)3-4-1-2-4/h4-5H,1-3H2.
What are the key properties of [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane?
[3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane has a molecular weight of 206.13 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3,3-trifluoro-2-(trifluoromethyl)propyl]cyclopropane is sourced from PubChem (CID 87736977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).