C11H7F8N — CID 87737101
3-[2,4-difluoro-3,4-bis(trifluoromethyl)cyclohexa-2,5-dien-1-yl]propanenitrile (PubChem CID 87737101) has the molecular formula C11H7F8N and a molecular weight of 305.17 g/mol. Its IUPAC name is 3-[2,4-difluoro-3,4-bis(trifluoromethyl)cyclohexa-2,5-dien-1-yl]propanenitrile.
| Compound Name | 3-[2,4-difluoro-3,4-bis(trifluoromethyl)cyclohexa-2,5-dien-1-yl]propanenitrile |
|---|---|
| PubChem CID | 87737101 |
| Molecular Formula | C11H7F8N |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-[2,4-difluoro-3,4-bis(trifluoromethyl)cyclohexa-2,5-dien-1-yl]propanenitrile |
| SMILES | N#CCCC1C=CC(F)(C(F)(F)F)C(C(F)(F)F)=C1F |
| InChI | InChI=1S/C11H7F8N/c12-7-6(2-1-5-20)3-4-9(13,11(17,18)19)8(7)10(14,15)16/h3-4,6H,1-2H2 |
| InChIKey | ITDZVLPBYFDHNZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|