C13H15F5N2OS — CID 87737280
1-ethyl-1,3-dimethyl-3-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]urea (PubChem CID 87737280) has the molecular formula C13H15F5N2OS and a molecular weight of 342.33 g/mol. Its IUPAC name is 1-ethyl-1,3-dimethyl-3-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]urea.
| Compound Name | 1-ethyl-1,3-dimethyl-3-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 87737280 |
| Molecular Formula | C13H15F5N2OS |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-ethyl-1,3-dimethyl-3-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]urea |
| SMILES | CCN(C)C(=O)N(C)c1ccc(SC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F5N2OS/c1-4-19(2)11(21)20(3)9-5-7-10(8-6-9)22-13(17,18)12(14,15)16/h5-8H,4H2,1-3H3 |
| InChIKey | KLVJMJHWPCHGRI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|