C28H28N4Na2O9S2 — CID 87737405
disodium;(2S)-2-amino-6-[2-[3-[(4-amino-9,10-dioxo-3-sulfonatoanthracen-1-yl)amino]phenyl]sulfonylethylamino]hexanoate (PubChem CID 87737405) has the molecular formula C28H28N4Na2O9S2 and a molecular weight of 674.67 g/mol. Its IUPAC name is disodium;(2S)-2-amino-6-[2-[3-[(4-amino-9,10-dioxo-3-sulfonatoanthracen-1-yl)amino]phenyl]sulfonylethylamino]hexanoate.
| Compound Name | disodium;(2S)-2-amino-6-[2-[3-[(4-amino-9,10-dioxo-3-sulfonatoanthracen-1-yl)amino]phenyl]sulfonylethylamino]hexanoate |
|---|---|
| PubChem CID | 87737405 |
| Molecular Formula | C28H28N4Na2O9S2 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | disodium;(2S)-2-amino-6-[2-[3-[(4-amino-9,10-dioxo-3-sulfonatoanthracen-1-yl)amino]phenyl]sulfonylethylamino]hexanoate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2cccc(S(=O)(=O)CCNCCCC[C@H](N)C(=O)[O-])c2)c2c1C(=O)c1ccccc1C2=O.[Na+].[Na+] |
| InChI | InChI=1S/C28H30N4O9S2.2Na/c29-20(28(35)36)10-3-4-11-31-12-13-42(37,38)17-7-5-6-16(14-17)32-21-15-22(43(39,40)41)25(30)24-23(21)26(33)18-8-1-2-9-19(18)27(24)34;;/h1-2,5-9,14-15,20,31-32H,3-4,10-13,29-30H2,(H,35,36)(H,39,40,41);;/q;2*+1/p-2/t20-;;/m0../s1 |
| InChIKey | DOTJAOGUCRCLKO-FJSYBICCSA-L |
| XLogP | -5.69 |
| TPSA | 241.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|