C11H26BF4NO2 — CID 87737614
triethyl-[2-(2-methoxyethoxy)ethyl]azanium tetrafluoroborate (PubChem CID 87737614) has the molecular formula C11H26BF4NO2 and a molecular weight of 291.14 g/mol. Its IUPAC name is triethyl-[2-(2-methoxyethoxy)ethyl]azanium tetrafluoroborate.
| Compound Name | triethyl-[2-(2-methoxyethoxy)ethyl]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 87737614 |
| Molecular Formula | C11H26BF4NO2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | triethyl-[2-(2-methoxyethoxy)ethyl]azanium tetrafluoroborate |
| SMILES | CC[N+](CC)(CC)CCOCCOC.F[B-](F)(F)F |
| InChI | InChI=1S/C11H26NO2.BF4/c1-5-12(6-2,7-3)8-9-14-11-10-13-4;2-1(3,4)5/h5-11H2,1-4H3;/q+1;-1 |
| InChIKey | XMEIPGXQHCOXKL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|