C19H26N6O3 — CID 87739288
N-[[(3R,5S)-3,5-dimethyl-1-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide (PubChem CID 87739288) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[[(3R,5S)-3,5-dimethyl-1-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[(3R,5S)-3,5-dimethyl-1-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87739288 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[[(3R,5S)-3,5-dimethyl-1-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
| SMILES | Cc1ccc2nc(NNC(=O)C3(CN(O)C=O)C[C@H](C)C[C@H](C)C3)nnc2c1 |
| InChI | InChI=1S/C19H26N6O3/c1-12-4-5-15-16(7-12)21-23-18(20-15)24-22-17(27)19(10-25(28)11-26)8-13(2)6-14(3)9-19/h4-5,7,11,13-14,28H,6,8-10H2,1-3H3,(H,22,27)(H,20,23,24)/t13-,14+,19? |
| InChIKey | JZLJSTDOAJVCDA-FSWDVZBNSA-N |
| XLogP | 2.07 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|