About (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one
(4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one (PubChem CID 87739369) has the molecular formula C19H38O4Si2
and a molecular weight of 386.68 g/mol. Its IUPAC name is (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one.
Molecular Properties
| Compound Name | (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one |
| PubChem CID | 87739369 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C12CO2 |
| InChI | InChI=1S/C19H38O4Si2/c1-17(2,3)24(7,8)22-15-11-14(20)12-16(19(15)13-21-19)23-25(9,10)18(4,5)6/h15-16H,11-13H2,1-10H3/t15-,16-/m1/s1 |
| InChIKey | YBOIMEUCJKYODF-HZPDHXFCSA-N |
| XLogP | 4.90 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one?
The IUPAC name of (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one (CID 87739369) is (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one.
What is the SMILES notation for (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one?
The canonical SMILES for (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one is CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C12CO2.
What is the InChIKey of (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one?
The InChIKey is YBOIMEUCJKYODF-HZPDHXFCSA-N. The full InChI is InChI=1S/C19H38O4Si2/c1-17(2,3)24(7,8)22-15-11-14(20)12-16(19(15)13-21-19)23-25(9,10)18(4,5)6/h15-16H,11-13H2,1-10H3/t15-,16-/m1/s1.
What are the key properties of (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one?
(4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one has a molecular weight of 386.68 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-one is sourced from PubChem (CID 87739369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).