C27H36Cl2N4OS — CID 87739485
N-[2-(3,4-dichlorophenyl)-4-[4-(2-sulfanyl-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methylbenzamide (PubChem CID 87739485) has the molecular formula C27H36Cl2N4OS and a molecular weight of 535.59 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-[4-(2-sulfanyl-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-[4-(2-sulfanyl-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 87739485 |
| Molecular Formula | C27H36Cl2N4OS |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-[4-(2-sulfanyl-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methylbenzamide |
| SMILES | CN(CC(CCN1CCC(N2CCCNC2S)CC1)c1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H36Cl2N4OS/c1-31(26(34)20-6-3-2-4-7-20)19-22(21-8-9-24(28)25(29)18-21)10-15-32-16-11-23(12-17-32)33-14-5-13-30-27(33)35/h2-4,6-9,18,22-23,27,30,35H,5,10-17,19H2,1H3 |
| InChIKey | QZZIOVMPMIXWRU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|