About 6-iodo-7H-purine;oxolane
6-iodo-7H-purine;oxolane (PubChem CID 87739519) has the molecular formula C13H19IN4O2
and a molecular weight of 390.23 g/mol. Its IUPAC name is 6-iodo-7H-purine;oxolane.
Molecular Properties
| Compound Name | 6-iodo-7H-purine;oxolane |
| PubChem CID | 87739519 |
| Molecular Formula | C13H19IN4O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 6-iodo-7H-purine;oxolane |
| SMILES | C1CCOC1.C1CCOC1.Ic1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H3IN4.2C4H8O/c6-4-3-5(9-1-7-3)10-2-8-4;2*1-2-4-5-3-1/h1-2H,(H,7,8,9,10);2*1-4H2 |
| InChIKey | HXJCEZBTEUDUCT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-7H-purine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-7H-purine;oxolane?
The IUPAC name of 6-iodo-7H-purine;oxolane (CID 87739519) is 6-iodo-7H-purine;oxolane.
What is the SMILES notation for 6-iodo-7H-purine;oxolane?
The canonical SMILES for 6-iodo-7H-purine;oxolane is C1CCOC1.C1CCOC1.Ic1ncnc2nc[nH]c12.
What is the InChIKey of 6-iodo-7H-purine;oxolane?
The InChIKey is HXJCEZBTEUDUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3IN4.2C4H8O/c6-4-3-5(9-1-7-3)10-2-8-4;2*1-2-4-5-3-1/h1-2H,(H,7,8,9,10);2*1-4H2.
What are the key properties of 6-iodo-7H-purine;oxolane?
6-iodo-7H-purine;oxolane has a molecular weight of 390.23 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-7H-purine;oxolane is sourced from PubChem (CID 87739519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).