C40H66O35P4 — CID 87739891
[(1S,2R,3S,4R,5S,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-propoxy-1-propylcyclohexyl] butanoate (PubChem CID 87739891) has the molecular formula C40H66O35P4 and a molecular weight of 1230.83 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5S,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-propoxy-1-propylcyclohexyl] butanoate.
| Compound Name | [(1S,2R,3S,4R,5S,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-propoxy-1-propylcyclohexyl] butanoate |
|---|---|
| PubChem CID | 87739891 |
| Molecular Formula | C40H66O35P4 |
| Molecular Weight | 1230.83 g/mol |
| Exact Mass | 1230.23 |
| IUPAC Name | [(1S,2R,3S,4R,5S,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-propoxy-1-propylcyclohexyl] butanoate |
| SMILES | CCCO[C@H]1[C@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@]1(CCC)OC(=O)CCC |
| InChI | InChI=1S/C40H66O35P4/c1-12-15-34(49)71-40(16-13-2)38(54-17-14-3)36(73-77(51,65-20-57-28(6)43)66-21-58-29(7)44)35(72-76(50,63-18-55-26(4)41)64-19-56-27(5)42)37(74-78(52,67-22-59-30(8)45)68-23-60-31(9)46)39(40)75-79(53,69-24-61-32(10)47)70-25-62-33(11)48/h35-39H,12-25H2,1-11H3/t35-,36-,37+,38+,39-,40+/m1/s1 |
| InChIKey | UBTKRLIQSKCGJP-RCMXNUQGSA-N |
| XLogP | 4.95 |
| TPSA | 424.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 35 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1230.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 35 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|