C15H19NO6 — CID 87740235
(1aR,2R,7bR)-2-(diethoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 87740235) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (1aR,2R,7bR)-2-(diethoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | (1aR,2R,7bR)-2-(diethoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 87740235 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (1aR,2R,7bR)-2-(diethoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | CCOC(OCC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H]2O[C@H]21 |
| InChI | InChI=1S/C15H19NO6/c1-4-19-14(20-5-2)15(3)13-12(21-13)10-8-9(16(17)18)6-7-11(10)22-15/h6-8,12-14H,4-5H2,1-3H3/t12-,13-,15-/m1/s1 |
| InChIKey | MOXAANOCUAPRRZ-UMVBOHGHSA-N |
| XLogP | 2.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|