C16H34O19P4 — CID 87740826
[(1R,2S,3R,4S,5R,6R)-2,3,4,5-tetraphosphonooxy-6-propoxy-1-propylcyclohexyl] butanoate (PubChem CID 87740826) has the molecular formula C16H34O19P4 and a molecular weight of 654.32 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5R,6R)-2,3,4,5-tetraphosphonooxy-6-propoxy-1-propylcyclohexyl] butanoate.
| Compound Name | [(1R,2S,3R,4S,5R,6R)-2,3,4,5-tetraphosphonooxy-6-propoxy-1-propylcyclohexyl] butanoate |
|---|---|
| PubChem CID | 87740826 |
| Molecular Formula | C16H34O19P4 |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 654.06 |
| IUPAC Name | [(1R,2S,3R,4S,5R,6R)-2,3,4,5-tetraphosphonooxy-6-propoxy-1-propylcyclohexyl] butanoate |
| SMILES | CCCO[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@]1(CCC)OC(=O)CCC |
| InChI | InChI=1S/C16H34O19P4/c1-4-7-10(17)31-16(8-5-2)14(30-9-6-3)12(33-37(21,22)23)11(32-36(18,19)20)13(34-38(24,25)26)15(16)35-39(27,28)29/h11-15H,4-9H2,1-3H3,(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)/t11-,12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | SXASFWWXARVFJK-UGYDUONOSA-N |
| XLogP | 0.59 |
| TPSA | 302.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|