C9H16N2S — CID 87740893
N-[2,2,2-trideuterio-1-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]ethanethioamide (PubChem CID 87740893) has the molecular formula C9H16N2S and a molecular weight of 187.33 g/mol. Its IUPAC name is N-[2,2,2-trideuterio-1-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]ethanethioamide.
| Compound Name | N-[2,2,2-trideuterio-1-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]ethanethioamide |
|---|---|
| PubChem CID | 87740893 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N-[2,2,2-trideuterio-1-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]ethanethioamide |
| SMILES | [2H]C([2H])([2H])C(NC(C)=S)C1=CCNCC1 |
| InChI | InChI=1S/C9H16N2S/c1-7(11-8(2)12)9-3-5-10-6-4-9/h3,7,10H,4-6H2,1-2H3,(H,11,12)/i1D3 |
| InChIKey | HKZPSNMADXFIMQ-FIBGUPNXSA-N |
| XLogP | 1.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|