C21H24N2O5S — CID 87740967
3-[(2R,3R,4S)-6-amino-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]-6-methyl-1,3-benzoxazole-2-thione (PubChem CID 87740967) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-[(2R,3R,4S)-6-amino-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]-6-methyl-1,3-benzoxazole-2-thione.
| Compound Name | 3-[(2R,3R,4S)-6-amino-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]-6-methyl-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 87740967 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[(2R,3R,4S)-6-amino-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]-6-methyl-1,3-benzoxazole-2-thione |
| SMILES | COC(OC)[C@]1(C)Oc2ccc(N)cc2[C@H](n2c(=S)oc3cc(C)ccc32)[C@H]1O |
| InChI | InChI=1S/C21H24N2O5S/c1-11-5-7-14-16(9-11)27-20(29)23(14)17-13-10-12(22)6-8-15(13)28-21(2,18(17)24)19(25-3)26-4/h5-10,17-19,24H,22H2,1-4H3/t17-,18+,21+/m0/s1 |
| InChIKey | VMNYZBVJRCKHBY-WAOWUJCRSA-N |
| XLogP | 3.57 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|