C37H58O35P4 — CID 87741080
[5,6,7,8-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-2,3,4,5,6,7,8,8a-octahydrochromen-4a-yl] butanoate (PubChem CID 87741080) has the molecular formula C37H58O35P4 and a molecular weight of 1186.73 g/mol. Its IUPAC name is [5,6,7,8-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-2,3,4,5,6,7,8,8a-octahydrochromen-4a-yl] butanoate.
| Compound Name | [5,6,7,8-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-2,3,4,5,6,7,8,8a-octahydrochromen-4a-yl] butanoate |
|---|---|
| PubChem CID | 87741080 |
| Molecular Formula | C37H58O35P4 |
| Molecular Weight | 1186.73 g/mol |
| Exact Mass | 1186.17 |
| IUPAC Name | [5,6,7,8-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-2,3,4,5,6,7,8,8a-octahydrochromen-4a-yl] butanoate |
| SMILES | CCCC(=O)OC12CCCOC1C(OP(=O)(OCOC(C)=O)OCOC(C)=O)C(OP(=O)(OCOC(C)=O)OCOC(C)=O)C(OP(=O)(OCOC(C)=O)OCOC(C)=O)C2OP(=O)(OCOC(C)=O)OCOC(C)=O |
| InChI | InChI=1S/C37H58O35P4/c1-10-12-31(46)68-37-13-11-14-51-35(37)33(70-74(48,62-17-54-25(4)40)63-18-55-26(5)41)32(69-73(47,60-15-52-23(2)38)61-16-53-24(3)39)34(71-75(49,64-19-56-27(6)42)65-20-57-28(7)43)36(37)72-76(50,66-21-58-29(8)44)67-22-59-30(9)45/h32-36H,10-22H2,1-9H3 |
| InChIKey | JVNJCKCJENSETR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 424.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 35 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 35 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|