About 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine
8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine (PubChem CID 87741330) has the molecular formula C20H30AlN
and a molecular weight of 311.45 g/mol. Its IUPAC name is 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine.
Molecular Properties
| Compound Name | 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine |
| PubChem CID | 87741330 |
| Molecular Formula | C20H30AlN |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine |
| SMILES | CCCC[Al](CCCC)c1cccc2cccc(N(C)C)c12 |
| InChI | InChI=1S/C12H12N.2C4H9.Al/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;2*1-3-4-2;/h3-7,9H,1-2H3;2*1,3-4H2,2H3; |
| InChIKey | HAWUTAVEISXHLV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine?
The IUPAC name of 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine (CID 87741330) is 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine.
What is the SMILES notation for 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine?
The canonical SMILES for 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine is CCCC[Al](CCCC)c1cccc2cccc(N(C)C)c12.
What is the InChIKey of 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine?
The InChIKey is HAWUTAVEISXHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N.2C4H9.Al/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;2*1-3-4-2;/h3-7,9H,1-2H3;2*1,3-4H2,2H3;.
What are the key properties of 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine?
8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine has a molecular weight of 311.45 g/mol, XLogP of 5.21, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-dibutylalumanyl-N,N-dimethylnaphthalen-1-amine is sourced from PubChem (CID 87741330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).