C10H7AlClF4N3S — CID 87741492
CID 87741492 (PubChem CID 87741492) has the molecular formula C10H7AlClF4N3S and a molecular weight of 339.68 g/mol.
| Compound Name | CID 87741492 |
|---|---|
| PubChem CID | 87741492 |
| Molecular Formula | C10H7AlClF4N3S |
| Molecular Weight | 339.68 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | — |
| SMILES | Cl.NC([Al])c1nc(-c2ccc(F)c(C(F)(F)F)c2)ns1 |
| InChI | InChI=1S/C10H6F4N3S.Al.ClH/c11-7-2-1-5(3-6(7)10(12,13)14)9-16-8(4-15)18-17-9;;/h1-4H,15H2;;1H |
| InChIKey | ILWZGSHUVDEERD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.68 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |