C22H23N3O3S — CID 87741502
(4-amino-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-6-yl) 4-methylbenzenesulfonate (PubChem CID 87741502) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (4-amino-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-6-yl) 4-methylbenzenesulfonate.
| Compound Name | (4-amino-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-6-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87741502 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (4-amino-3,5-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2(7),3,5,13,15-hexaen-6-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(N)nc3c2CCCCCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15-11-13-17(14-12-15)29(26,27)28-21-19-10-4-2-3-7-16-8-5-6-9-18(16)20(19)24-22(23)25-21/h5-6,8-9,11-14H,2-4,7,10H2,1H3,(H2,23,24,25) |
| InChIKey | WMGQLLDWKSSKMX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|